C26H37Cl2N3O4S — CID 83272545
[2-[[tert-butylcarbamoyl(2-methylpropyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 83272545) has the molecular formula C26H37Cl2N3O4S and a molecular weight of 558.57 g/mol. Its IUPAC name is [2-[[tert-butylcarbamoyl(2-methylpropyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [2-[[tert-butylcarbamoyl(2-methylpropyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 83272545 |
| Molecular Formula | C26H37Cl2N3O4S |
| Molecular Weight | 558.57 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | [2-[[tert-butylcarbamoyl(2-methylpropyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CCN(CC)c1ccc(CN(CC(C)C)C(=O)NC(C)(C)C)c(OS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C26H37Cl2N3O4S/c1-8-30(9-2)20-11-10-19(17-31(16-18(3)4)25(32)29-26(5,6)7)24(14-20)35-36(33,34)21-12-13-22(27)23(28)15-21/h10-15,18H,8-9,16-17H2,1-7H3,(H,29,32) |
| InChIKey | NWGINDQPXANYRV-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|