C21H26Cl2N2O5S — CID 71956885
[5-[[ethylcarbamoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 71956885) has the molecular formula C21H26Cl2N2O5S and a molecular weight of 489.42 g/mol. Its IUPAC name is [5-[[ethylcarbamoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [5-[[ethylcarbamoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 71956885 |
| Molecular Formula | C21H26Cl2N2O5S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | [5-[[ethylcarbamoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CCNC(=O)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1)CC(C)C |
| InChI | InChI=1S/C21H26Cl2N2O5S/c1-5-24-21(26)25(12-14(2)3)13-15-6-9-19(29-4)20(10-15)30-31(27,28)16-7-8-17(22)18(23)11-16/h6-11,14H,5,12-13H2,1-4H3,(H,24,26) |
| InChIKey | DGSZVXXXZLYUBE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|