C19H19Cl2NO5S — CID 71955437
[5-[[acetyl(cyclopropyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 71955437) has the molecular formula C19H19Cl2NO5S and a molecular weight of 444.34 g/mol. Its IUPAC name is [5-[[acetyl(cyclopropyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [5-[[acetyl(cyclopropyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 71955437 |
| Molecular Formula | C19H19Cl2NO5S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | [5-[[acetyl(cyclopropyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | COc1ccc(CN(C(C)=O)C2CC2)cc1OS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2NO5S/c1-12(23)22(14-4-5-14)11-13-3-8-18(26-2)19(9-13)27-28(24,25)15-6-7-16(20)17(21)10-15/h3,6-10,14H,4-5,11H2,1-2H3 |
| InChIKey | TVHGNPJJRWZODV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|