C13H17NO4S — CID 42669661
[3-[[acetyl(cyclopropyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 42669661) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is [3-[[acetyl(cyclopropyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[acetyl(cyclopropyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 42669661 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | [3-[[acetyl(cyclopropyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC(=O)N(Cc1cccc(OS(C)(=O)=O)c1)C1CC1 |
| InChI | InChI=1S/C13H17NO4S/c1-10(15)14(12-6-7-12)9-11-4-3-5-13(8-11)18-19(2,16)17/h3-5,8,12H,6-7,9H2,1-2H3 |
| InChIKey | NFKWYXZPUDYFKR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|