C15H22ClNO4S — CID 7127163
[3-[[[(2S)-butan-2-yl]-[(2R)-2-chloropropanoyl]amino]methyl]phenyl] methanesulfonate (PubChem CID 7127163) has the molecular formula C15H22ClNO4S and a molecular weight of 347.86 g/mol. Its IUPAC name is [3-[[[(2S)-butan-2-yl]-[(2R)-2-chloropropanoyl]amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[[(2S)-butan-2-yl]-[(2R)-2-chloropropanoyl]amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7127163 |
| Molecular Formula | C15H22ClNO4S |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [3-[[[(2S)-butan-2-yl]-[(2R)-2-chloropropanoyl]amino]methyl]phenyl] methanesulfonate |
| SMILES | CC[C@H](C)N(Cc1cccc(OS(C)(=O)=O)c1)C(=O)[C@@H](C)Cl |
| InChI | InChI=1S/C15H22ClNO4S/c1-5-11(2)17(15(18)12(3)16)10-13-7-6-8-14(9-13)21-22(4,19)20/h6-9,11-12H,5,10H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | OCGSTHCXPYSNET-NWDGAFQWSA-N |
| XLogP | 2.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|