C16H25NO4S — CID 42775495
[3-[[butanoyl(butan-2-yl)amino]methyl]phenyl] methanesulfonate (PubChem CID 42775495) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is [3-[[butanoyl(butan-2-yl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[butanoyl(butan-2-yl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 42775495 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | [3-[[butanoyl(butan-2-yl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CCCC(=O)N(Cc1cccc(OS(C)(=O)=O)c1)C(C)CC |
| InChI | InChI=1S/C16H25NO4S/c1-5-8-16(18)17(13(3)6-2)12-14-9-7-10-15(11-14)21-22(4,19)20/h7,9-11,13H,5-6,8,12H2,1-4H3 |
| InChIKey | KPISVHPMYJIAGV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|