C19H29NO6S — CID 7249251
ethyl 4-[[(2R)-butan-2-yl]-[(3-ethylsulfonyloxyphenyl)methyl]amino]-4-oxobutanoate (PubChem CID 7249251) has the molecular formula C19H29NO6S and a molecular weight of 399.51 g/mol. Its IUPAC name is ethyl 4-[[(2R)-butan-2-yl]-[(3-ethylsulfonyloxyphenyl)methyl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[(2R)-butan-2-yl]-[(3-ethylsulfonyloxyphenyl)methyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 7249251 |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | ethyl 4-[[(2R)-butan-2-yl]-[(3-ethylsulfonyloxyphenyl)methyl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(Cc1cccc(OS(=O)(=O)CC)c1)[C@H](C)CC |
| InChI | InChI=1S/C19H29NO6S/c1-5-15(4)20(18(21)11-12-19(22)25-6-2)14-16-9-8-10-17(13-16)26-27(23,24)7-3/h8-10,13,15H,5-7,11-12,14H2,1-4H3/t15-/m1/s1 |
| InChIKey | NOPVFUOUZZCDPR-OAHLLOKOSA-N |
| XLogP | 2.89 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|