C20H24FNO4S — CID 7249945
[3-[[[(2S)-butan-2-yl]-(3-fluorobenzoyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 7249945) has the molecular formula C20H24FNO4S and a molecular weight of 393.48 g/mol. Its IUPAC name is [3-[[[(2S)-butan-2-yl]-(3-fluorobenzoyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[[(2S)-butan-2-yl]-(3-fluorobenzoyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 7249945 |
| Molecular Formula | C20H24FNO4S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [3-[[[(2S)-butan-2-yl]-(3-fluorobenzoyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CC[C@H](C)N(Cc1cccc(OS(=O)(=O)CC)c1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C20H24FNO4S/c1-4-15(3)22(20(23)17-9-7-10-18(21)13-17)14-16-8-6-11-19(12-16)26-27(24,25)5-2/h6-13,15H,4-5,14H2,1-3H3/t15-/m0/s1 |
| InChIKey | LDJNNURNJKITKW-HNNXBMFYSA-N |
| XLogP | 4.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|