C19H24FNO5S2 — CID 4294989
[3-[[butan-2-yl-(4-fluorophenyl)sulfonylamino]methyl]phenyl] ethanesulfonate (PubChem CID 4294989) has the molecular formula C19H24FNO5S2 and a molecular weight of 429.54 g/mol. Its IUPAC name is [3-[[butan-2-yl-(4-fluorophenyl)sulfonylamino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[butan-2-yl-(4-fluorophenyl)sulfonylamino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4294989 |
| Molecular Formula | C19H24FNO5S2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | [3-[[butan-2-yl-(4-fluorophenyl)sulfonylamino]methyl]phenyl] ethanesulfonate |
| SMILES | CCC(C)N(Cc1cccc(OS(=O)(=O)CC)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H24FNO5S2/c1-4-15(3)21(28(24,25)19-11-9-17(20)10-12-19)14-16-7-6-8-18(13-16)26-27(22,23)5-2/h6-13,15H,4-5,14H2,1-3H3 |
| InChIKey | DFSVFEPNRKHILB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|