C23H22FNO4S — CID 3577674
[3-[[benzoyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3577674) has the molecular formula C23H22FNO4S and a molecular weight of 427.50 g/mol. Its IUPAC name is [3-[[benzoyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[benzoyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3577674 |
| Molecular Formula | C23H22FNO4S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [3-[[benzoyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H22FNO4S/c1-17(2)25(23(26)19-8-4-3-5-9-19)16-18-7-6-10-21(15-18)29-30(27,28)22-13-11-20(24)12-14-22/h3-15,17H,16H2,1-2H3 |
| InChIKey | PBVHBJGHKOROOP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|