C25H26FNO5S — CID 4120583
[3-[[(4-methoxybenzoyl)-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4120583) has the molecular formula C25H26FNO5S and a molecular weight of 471.55 g/mol. Its IUPAC name is [3-[[(4-methoxybenzoyl)-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[(4-methoxybenzoyl)-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4120583 |
| Molecular Formula | C25H26FNO5S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [3-[[(4-methoxybenzoyl)-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1ccc(C(=O)N(Cc2cccc(OS(=O)(=O)c3ccc(F)cc3)c2)CC(C)C)cc1 |
| InChI | InChI=1S/C25H26FNO5S/c1-18(2)16-27(25(28)20-7-11-22(31-3)12-8-20)17-19-5-4-6-23(15-19)32-33(29,30)24-13-9-21(26)10-14-24/h4-15,18H,16-17H2,1-3H3 |
| InChIKey | SRWCZEVLTCOHHO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|