C18H27NO4S — CID 3668371
[3-[[cyclopentanecarbonyl(2-methylpropyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 3668371) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is [3-[[cyclopentanecarbonyl(2-methylpropyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[cyclopentanecarbonyl(2-methylpropyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3668371 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | [3-[[cyclopentanecarbonyl(2-methylpropyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC(C)CN(Cc1cccc(OS(C)(=O)=O)c1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C18H27NO4S/c1-14(2)12-19(18(20)16-8-4-5-9-16)13-15-7-6-10-17(11-15)23-24(3,21)22/h6-7,10-11,14,16H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | BRKPTSMGRZSGJG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|