C21H28N2O4S — CID 4181322
[3-[[(4-ethylphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 4181322) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is [3-[[(4-ethylphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[(4-ethylphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4181322 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [3-[[(4-ethylphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CCc1ccc(NC(=O)N(Cc2cccc(OS(C)(=O)=O)c2)CC(C)C)cc1 |
| InChI | InChI=1S/C21H28N2O4S/c1-5-17-9-11-19(12-10-17)22-21(24)23(14-16(2)3)15-18-7-6-8-20(13-18)27-28(4,25)26/h6-13,16H,5,14-15H2,1-4H3,(H,22,24) |
| InChIKey | QWAWEPVRHXRWNN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|