C22H28N2O6S — CID 3554898
ethyl 4-[[2-methylpropyl-[(4-methylsulfonyloxyphenyl)methyl]carbamoyl]amino]benzoate (PubChem CID 3554898) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is ethyl 4-[[2-methylpropyl-[(4-methylsulfonyloxyphenyl)methyl]carbamoyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-methylpropyl-[(4-methylsulfonyloxyphenyl)methyl]carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 3554898 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | ethyl 4-[[2-methylpropyl-[(4-methylsulfonyloxyphenyl)methyl]carbamoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N(Cc2ccc(OS(C)(=O)=O)cc2)CC(C)C)cc1 |
| InChI | InChI=1S/C22H28N2O6S/c1-5-29-21(25)18-8-10-19(11-9-18)23-22(26)24(14-16(2)3)15-17-6-12-20(13-7-17)30-31(4,27)28/h6-13,16H,5,14-15H2,1-4H3,(H,23,26) |
| InChIKey | LVSATTIIBSYFKW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|