C20H23N3O4S — CID 46123286
[4-[[(3-cyanophenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 46123286) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is [4-[[(3-cyanophenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[(3-cyanophenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 46123286 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [4-[[(3-cyanophenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC(C)CN(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C20H23N3O4S/c1-15(2)13-23(20(24)22-18-6-4-5-17(11-18)12-21)14-16-7-9-19(10-8-16)27-28(3,25)26/h4-11,15H,13-14H2,1-3H3,(H,22,24) |
| InChIKey | FISKTLZQAOCHLS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|