C18H25NO4S — CID 71955095
[3-[[cyclobutanecarbonyl(cyclopropylmethyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 71955095) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is [3-[[cyclobutanecarbonyl(cyclopropylmethyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[cyclobutanecarbonyl(cyclopropylmethyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 71955095 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [3-[[cyclobutanecarbonyl(cyclopropylmethyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(CN(CC2CC2)C(=O)C2CCC2)c1 |
| InChI | InChI=1S/C18H25NO4S/c1-2-24(21,22)23-17-8-3-5-15(11-17)13-19(12-14-9-10-14)18(20)16-6-4-7-16/h3,5,8,11,14,16H,2,4,6-7,9-10,12-13H2,1H3 |
| InChIKey | IDHCVBSSUPRLTB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|