C22H27NO4S — CID 11903490
[3-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]-propan-2-ylamino]methyl]phenyl] ethanesulfonate (PubChem CID 11903490) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is [3-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]-propan-2-ylamino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]-propan-2-ylamino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 11903490 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [3-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]-propan-2-ylamino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(CN(C(=O)[C@@H]2C[C@H]2c2ccccc2)C(C)C)c1 |
| InChI | InChI=1S/C22H27NO4S/c1-4-28(25,26)27-19-12-8-9-17(13-19)15-23(16(2)3)22(24)21-14-20(21)18-10-6-5-7-11-18/h5-13,16,20-21H,4,14-15H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | COCPLEKHQDMQIA-LEWJYISDSA-N |
| XLogP | 3.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|