C19H22ClFN2O4S — CID 4048694
[3-[[(3-chloro-4-fluorophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] ethanesulfonate (PubChem CID 4048694) has the molecular formula C19H22ClFN2O4S and a molecular weight of 428.91 g/mol. Its IUPAC name is [3-[[(3-chloro-4-fluorophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[(3-chloro-4-fluorophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4048694 |
| Molecular Formula | C19H22ClFN2O4S |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [3-[[(3-chloro-4-fluorophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(CN(C(=O)Nc2ccc(F)c(Cl)c2)C(C)C)c1 |
| InChI | InChI=1S/C19H22ClFN2O4S/c1-4-28(25,26)27-16-7-5-6-14(10-16)12-23(13(2)3)19(24)22-15-8-9-18(21)17(20)11-15/h5-11,13H,4,12H2,1-3H3,(H,22,24) |
| InChIKey | CBABNKLSYSIGCI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|