C20H24Cl2N2O4S — CID 3539960
[4-[[butan-2-yl-[(3,4-dichlorophenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate (PubChem CID 3539960) has the molecular formula C20H24Cl2N2O4S and a molecular weight of 459.40 g/mol. Its IUPAC name is [4-[[butan-2-yl-[(3,4-dichlorophenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[butan-2-yl-[(3,4-dichlorophenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 3539960 |
| Molecular Formula | C20H24Cl2N2O4S |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | [4-[[butan-2-yl-[(3,4-dichlorophenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OS(=O)(=O)CC)cc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H24Cl2N2O4S/c1-4-14(3)24(20(25)23-16-8-11-18(21)19(22)12-16)13-15-6-9-17(10-7-15)28-29(26,27)5-2/h6-12,14H,4-5,13H2,1-3H3,(H,23,25) |
| InChIKey | ZLRRHOWBRDVCAN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|