C22H30N2O4S — CID 7297333
[4-[[[(2R)-butan-2-yl]-[(2-ethylphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate (PubChem CID 7297333) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is [4-[[[(2R)-butan-2-yl]-[(2-ethylphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[[(2R)-butan-2-yl]-[(2-ethylphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 7297333 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [4-[[[(2R)-butan-2-yl]-[(2-ethylphenyl)carbamoyl]amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCc1ccccc1NC(=O)N(Cc1ccc(OS(=O)(=O)CC)cc1)[C@H](C)CC |
| InChI | InChI=1S/C22H30N2O4S/c1-5-17(4)24(22(25)23-21-11-9-8-10-19(21)6-2)16-18-12-14-20(15-13-18)28-29(26,27)7-3/h8-15,17H,5-7,16H2,1-4H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | JEHQWKUSJYVYGD-QGZVFWFLSA-N |
| XLogP | 4.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|