C23H21Cl2FN2O4S — CID 4615517
[3-[[(2,4-dichlorophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4615517) has the molecular formula C23H21Cl2FN2O4S and a molecular weight of 511.40 g/mol. Its IUPAC name is [3-[[(2,4-dichlorophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[(2,4-dichlorophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4615517 |
| Molecular Formula | C23H21Cl2FN2O4S |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | [3-[[(2,4-dichlorophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H21Cl2FN2O4S/c1-15(2)28(23(29)27-22-11-6-17(24)13-21(22)25)14-16-4-3-5-19(12-16)32-33(30,31)20-9-7-18(26)8-10-20/h3-13,15H,14H2,1-2H3,(H,27,29) |
| InChIKey | HASTYTLMHDZOCN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|