C25H24Cl2FNO5S — CID 98421321
[5-[[[(2S)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 98421321) has the molecular formula C25H24Cl2FNO5S and a molecular weight of 540.44 g/mol. Its IUPAC name is [5-[[[(2S)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [5-[[[(2S)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 98421321 |
| Molecular Formula | C25H24Cl2FNO5S |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | [5-[[[(2S)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C25H24Cl2FNO5S/c1-4-16(2)29(25(30)19-7-5-6-8-22(19)28)15-17-9-12-23(33-3)24(13-17)34-35(31,32)18-10-11-20(26)21(27)14-18/h5-14,16H,4,15H2,1-3H3/t16-/m0/s1 |
| InChIKey | WRDMARJGORFBCC-INIZCTEOSA-N |
| XLogP | 6.35 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|