C19H22ClNO5S — CID 5010094
[5-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 5010094) has the molecular formula C19H22ClNO5S and a molecular weight of 411.91 g/mol. Its IUPAC name is [5-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 5010094 |
| Molecular Formula | C19H22ClNO5S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | [5-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1ccc(CN(C(=O)c2ccccc2Cl)C(C)C)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C19H22ClNO5S/c1-13(2)21(19(22)15-7-5-6-8-16(15)20)12-14-9-10-17(25-3)18(11-14)26-27(4,23)24/h5-11,13H,12H2,1-4H3 |
| InChIKey | OEGVHRQMYRNCOL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|