C23H26N2O5S — CID 3634555
[2-methoxy-5-[[naphthalen-1-ylcarbamoyl(propan-2-yl)amino]methyl]phenyl] methanesulfonate (PubChem CID 3634555) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is [2-methoxy-5-[[naphthalen-1-ylcarbamoyl(propan-2-yl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [2-methoxy-5-[[naphthalen-1-ylcarbamoyl(propan-2-yl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3634555 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [2-methoxy-5-[[naphthalen-1-ylcarbamoyl(propan-2-yl)amino]methyl]phenyl] methanesulfonate |
| SMILES | COc1ccc(CN(C(=O)Nc2cccc3ccccc23)C(C)C)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C23H26N2O5S/c1-16(2)25(15-17-12-13-21(29-3)22(14-17)30-31(4,27)28)23(26)24-20-11-7-9-18-8-5-6-10-19(18)20/h5-14,16H,15H2,1-4H3,(H,24,26) |
| InChIKey | UOQOXQIZHJUOSG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|