C20H25BrN2O5S — CID 4072511
[5-[[(2-bromophenyl)carbamoyl-propan-2-ylamino]methyl]-2-methoxyphenyl] ethanesulfonate (PubChem CID 4072511) has the molecular formula C20H25BrN2O5S and a molecular weight of 485.40 g/mol. Its IUPAC name is [5-[[(2-bromophenyl)carbamoyl-propan-2-ylamino]methyl]-2-methoxyphenyl] ethanesulfonate.
| Compound Name | [5-[[(2-bromophenyl)carbamoyl-propan-2-ylamino]methyl]-2-methoxyphenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4072511 |
| Molecular Formula | C20H25BrN2O5S |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | [5-[[(2-bromophenyl)carbamoyl-propan-2-ylamino]methyl]-2-methoxyphenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cc(CN(C(=O)Nc2ccccc2Br)C(C)C)ccc1OC |
| InChI | InChI=1S/C20H25BrN2O5S/c1-5-29(25,26)28-19-12-15(10-11-18(19)27-4)13-23(14(2)3)20(24)22-17-9-7-6-8-16(17)21/h6-12,14H,5,13H2,1-4H3,(H,22,24) |
| InChIKey | PXLIAFNLZQUJEN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|