C20H24ClNO5S — CID 4983938
[5-[[(2-chlorobenzoyl)-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 4983938) has the molecular formula C20H24ClNO5S and a molecular weight of 425.93 g/mol. Its IUPAC name is [5-[[(2-chlorobenzoyl)-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[(2-chlorobenzoyl)-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 4983938 |
| Molecular Formula | C20H24ClNO5S |
| Molecular Weight | 425.93 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [5-[[(2-chlorobenzoyl)-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1ccc(CN(CC(C)C)C(=O)c2ccccc2Cl)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C20H24ClNO5S/c1-14(2)12-22(20(23)16-7-5-6-8-17(16)21)13-15-9-10-18(26-3)19(11-15)27-28(4,24)25/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | JASJZGLJCGCFLD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.93 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|