C22H37NO5S — CID 7288550
[2-methoxy-5-[[2-methylpropyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] methanesulfonate (PubChem CID 7288550) has the molecular formula C22H37NO5S and a molecular weight of 427.61 g/mol. Its IUPAC name is [2-methoxy-5-[[2-methylpropyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] methanesulfonate.
| Compound Name | [2-methoxy-5-[[2-methylpropyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7288550 |
| Molecular Formula | C22H37NO5S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | [2-methoxy-5-[[2-methylpropyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] methanesulfonate |
| SMILES | COc1ccc(CN(CC(C)C)C(=O)C[C@@H](C)CC(C)(C)C)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C22H37NO5S/c1-16(2)14-23(21(24)11-17(3)13-22(4,5)6)15-18-9-10-19(27-7)20(12-18)28-29(8,25)26/h9-10,12,16-17H,11,13-15H2,1-8H3/t17-/m1/s1 |
| InChIKey | GIYNOMYUCVHXBS-QGZVFWFLSA-N |
| XLogP | 4.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|