C28H42N2O3 — CID 42695446
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(dimethylamino)phenyl]methyl]-3,5,5-trimethylhexanamide (PubChem CID 42695446) has the molecular formula C28H42N2O3 and a molecular weight of 454.66 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(dimethylamino)phenyl]methyl]-3,5,5-trimethylhexanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(dimethylamino)phenyl]methyl]-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 42695446 |
| Molecular Formula | C28H42N2O3 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(dimethylamino)phenyl]methyl]-3,5,5-trimethylhexanamide |
| SMILES | COc1ccc(CCN(Cc2ccc(N(C)C)cc2)C(=O)CC(C)CC(C)(C)C)cc1OC |
| InChI | InChI=1S/C28H42N2O3/c1-21(19-28(2,3)4)17-27(31)30(20-23-9-12-24(13-10-23)29(5)6)16-15-22-11-14-25(32-7)26(18-22)33-8/h9-14,18,21H,15-17,19-20H2,1-8H3 |
| InChIKey | OOFOIGAFBGFGSB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|