C20H33NO5S — CID 42775459
[3-[[2-methoxyethyl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 42775459) has the molecular formula C20H33NO5S and a molecular weight of 399.55 g/mol. Its IUPAC name is [3-[[2-methoxyethyl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[2-methoxyethyl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 42775459 |
| Molecular Formula | C20H33NO5S |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | [3-[[2-methoxyethyl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | COCCN(Cc1cccc(OS(C)(=O)=O)c1)C(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C20H33NO5S/c1-16(14-20(2,3)4)12-19(22)21(10-11-25-5)15-17-8-7-9-18(13-17)26-27(6,23)24/h7-9,13,16H,10-12,14-15H2,1-6H3 |
| InChIKey | PEOJFTFNNDBDOW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|