C22H31NO6S2 — CID 42776979
[2-methoxy-5-[[2-methylpropyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]phenyl] methanesulfonate (PubChem CID 42776979) has the molecular formula C22H31NO6S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is [2-methoxy-5-[[2-methylpropyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]phenyl] methanesulfonate.
| Compound Name | [2-methoxy-5-[[2-methylpropyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 42776979 |
| Molecular Formula | C22H31NO6S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [2-methoxy-5-[[2-methylpropyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]phenyl] methanesulfonate |
| SMILES | COc1ccc(CN(CC(C)C)S(=O)(=O)c2c(C)cc(C)cc2C)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C22H31NO6S2/c1-15(2)13-23(31(26,27)22-17(4)10-16(3)11-18(22)5)14-19-8-9-20(28-6)21(12-19)29-30(7,24)25/h8-12,15H,13-14H2,1-7H3 |
| InChIKey | VIJPIIPBGPKHGC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|