C21H29NO5S2 — CID 92913416
[4-[[[(2S)-butan-2-yl]-(2,4,6-trimethylphenyl)sulfonylamino]methyl]phenyl] methanesulfonate (PubChem CID 92913416) has the molecular formula C21H29NO5S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is [4-[[[(2S)-butan-2-yl]-(2,4,6-trimethylphenyl)sulfonylamino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[[(2S)-butan-2-yl]-(2,4,6-trimethylphenyl)sulfonylamino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 92913416 |
| Molecular Formula | C21H29NO5S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [4-[[[(2S)-butan-2-yl]-(2,4,6-trimethylphenyl)sulfonylamino]methyl]phenyl] methanesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(OS(C)(=O)=O)cc1)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H29NO5S2/c1-7-18(5)22(14-19-8-10-20(11-9-19)27-28(6,23)24)29(25,26)21-16(3)12-15(2)13-17(21)4/h8-13,18H,7,14H2,1-6H3/t18-/m0/s1 |
| InChIKey | WBHMDQHEXBGRDR-SFHVURJKSA-N |
| XLogP | 3.94 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|