About N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide
N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide (PubChem CID 10381159) has the molecular formula C15H24ClNO2S
and a molecular weight of 317.88 g/mol. Its IUPAC name is N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide |
| PubChem CID | 10381159 |
| Molecular Formula | C15H24ClNO2S |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CCCCl)C(C)C)c(C)c1 |
| InChI | InChI=1S/C15H24ClNO2S/c1-11(2)17(8-6-7-16)20(18,19)15-13(4)9-12(3)10-14(15)5/h9-11H,6-8H2,1-5H3 |
| InChIKey | QDUJZVSBIJDACT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide?
The IUPAC name of N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide (CID 10381159) is N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide.
What is the SMILES notation for N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide?
The canonical SMILES for N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide is Cc1cc(C)c(S(=O)(=O)N(CCCCl)C(C)C)c(C)c1.
What is the InChIKey of N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide?
The InChIKey is QDUJZVSBIJDACT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24ClNO2S/c1-11(2)17(8-6-7-16)20(18,19)15-13(4)9-12(3)10-14(15)5/h9-11H,6-8H2,1-5H3.
What are the key properties of N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide?
N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide has a molecular weight of 317.88 g/mol, XLogP of 3.64, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloropropyl)-2,4,6-trimethyl-N-propan-2-ylbenzenesulfonamide is sourced from PubChem (CID 10381159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).