C16H26FNO2S — CID 107326899
N-butan-2-yl-N-butyl-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 107326899) has the molecular formula C16H26FNO2S and a molecular weight of 315.45 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-butan-2-yl-N-butyl-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107326899 |
| Molecular Formula | C16H26FNO2S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-butan-2-yl-N-butyl-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | CCCCN(C(C)CC)S(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C16H26FNO2S/c1-6-8-9-18(14(5)7-2)21(19,20)16-12(3)10-15(17)11-13(16)4/h10-11,14H,6-9H2,1-5H3 |
| InChIKey | QVEWWNBZWIMFBP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |