C13H17ClF3NO2S — CID 63396675
N-(3-chloropropyl)-N-propan-2-yl-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 63396675) has the molecular formula C13H17ClF3NO2S and a molecular weight of 343.80 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-propan-2-yl-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-chloropropyl)-N-propan-2-yl-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63396675 |
| Molecular Formula | C13H17ClF3NO2S |
| Molecular Weight | 343.80 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-(3-chloropropyl)-N-propan-2-yl-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)N(CCCCl)S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H17ClF3NO2S/c1-10(2)18(9-5-8-14)21(19,20)12-7-4-3-6-11(12)13(15,16)17/h3-4,6-7,10H,5,8-9H2,1-2H3 |
| InChIKey | PTNOCINWYVDESK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|