C19H23ClN2O8S2 — CID 42776978
[5-[[(4-chloro-3-nitrophenyl)sulfonyl-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 42776978) has the molecular formula C19H23ClN2O8S2 and a molecular weight of 506.99 g/mol. Its IUPAC name is [5-[[(4-chloro-3-nitrophenyl)sulfonyl-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [5-[[(4-chloro-3-nitrophenyl)sulfonyl-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 42776978 |
| Molecular Formula | C19H23ClN2O8S2 |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | [5-[[(4-chloro-3-nitrophenyl)sulfonyl-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1ccc(CN(CC(C)C)S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C19H23ClN2O8S2/c1-13(2)11-21(32(27,28)15-6-7-16(20)17(10-15)22(23)24)12-14-5-8-18(29-3)19(9-14)30-31(4,25)26/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | GOEYFPKANPXOSJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|