C22H23N2O6PS — CID 170368358
N,N-bis[(4-methoxyphenyl)methyl]-3-nitro-4-phosphanylbenzenesulfonamide (PubChem CID 170368358) has the molecular formula C22H23N2O6PS and a molecular weight of 474.48 g/mol. Its IUPAC name is N,N-bis[(4-methoxyphenyl)methyl]-3-nitro-4-phosphanylbenzenesulfonamide.
| Compound Name | N,N-bis[(4-methoxyphenyl)methyl]-3-nitro-4-phosphanylbenzenesulfonamide |
|---|---|
| PubChem CID | 170368358 |
| Molecular Formula | C22H23N2O6PS |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N,N-bis[(4-methoxyphenyl)methyl]-3-nitro-4-phosphanylbenzenesulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2ccc(P)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H23N2O6PS/c1-29-18-7-3-16(4-8-18)14-23(15-17-5-9-19(30-2)10-6-17)32(27,28)20-11-12-22(31)21(13-20)24(25)26/h3-13H,14-15,31H2,1-2H3 |
| InChIKey | ZLHUMZLITZDZCU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|