C34H33ClN2O8S — CID 146545503
4-[[(1R)-6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-N,N-bis[(4-methoxyphenyl)methyl]-3-nitrobenzenesulfonamide (PubChem CID 146545503) has the molecular formula C34H33ClN2O8S and a molecular weight of 665.16 g/mol. Its IUPAC name is 4-[[(1R)-6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-N,N-bis[(4-methoxyphenyl)methyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[(1R)-6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-N,N-bis[(4-methoxyphenyl)methyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 146545503 |
| Molecular Formula | C34H33ClN2O8S |
| Molecular Weight | 665.16 g/mol |
| Exact Mass | 664.16 |
| IUPAC Name | 4-[[(1R)-6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-N,N-bis[(4-methoxyphenyl)methyl]-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2ccc(OC[C@@]3(C=O)CCCc4cc(Cl)ccc43)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C34H33ClN2O8S/c1-43-28-10-5-24(6-11-28)20-36(21-25-7-12-29(44-2)13-8-25)46(41,42)30-14-16-33(32(19-30)37(39)40)45-23-34(22-38)17-3-4-26-18-27(35)9-15-31(26)34/h5-16,18-19,22H,3-4,17,20-21,23H2,1-2H3/t34-/m0/s1 |
| InChIKey | WQUBIBBJYUYLMS-UMSFTDKQSA-N |
| XLogP | 6.51 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.16 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|