C33H31ClN2O9S — CID 166728797
(1S)-1-[[4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-nitrophenoxy]methyl]-3,4-dihydro-1H-isochromene-6-carbonyl chloride (PubChem CID 166728797) has the molecular formula C33H31ClN2O9S and a molecular weight of 667.14 g/mol. Its IUPAC name is (1S)-1-[[4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-nitrophenoxy]methyl]-3,4-dihydro-1H-isochromene-6-carbonyl chloride.
| Compound Name | (1S)-1-[[4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-nitrophenoxy]methyl]-3,4-dihydro-1H-isochromene-6-carbonyl chloride |
|---|---|
| PubChem CID | 166728797 |
| Molecular Formula | C33H31ClN2O9S |
| Molecular Weight | 667.14 g/mol |
| Exact Mass | 666.14 |
| IUPAC Name | (1S)-1-[[4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]-2-nitrophenoxy]methyl]-3,4-dihydro-1H-isochromene-6-carbonyl chloride |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2ccc(OC[C@H]3OCCc4cc(C(=O)Cl)ccc43)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C33H31ClN2O9S/c1-42-26-8-3-22(4-9-26)19-35(20-23-5-10-27(43-2)11-6-23)46(40,41)28-12-14-31(30(18-28)36(38)39)45-21-32-29-13-7-25(33(34)37)17-24(29)15-16-44-32/h3-14,17-18,32H,15-16,19-21H2,1-2H3/t32-/m1/s1 |
| InChIKey | LGVXIRZJAMYQMM-JGCGQSQUSA-N |
| XLogP | 6.07 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.14 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|