C12H15N2O7S- — CID 7127670
2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetate (PubChem CID 7127670) has the molecular formula C12H15N2O7S- and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetate.
| Compound Name | 2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 7127670 |
| Molecular Formula | C12H15N2O7S- |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OCC(=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O7S/c1-3-13(4-2)22(19,20)9-5-6-11(21-8-12(15)16)10(7-9)14(17)18/h5-7H,3-4,8H2,1-2H3,(H,15,16)/p-1 |
| InChIKey | ZQTFODJAPSGKLT-UHFFFAOYSA-M |
| XLogP | -0.25 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|