C14H18F3N3O6S — CID 4215025
2-[4-(diethylsulfamoyl)-2-nitrophenoxy]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 4215025) has the molecular formula C14H18F3N3O6S and a molecular weight of 413.37 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)-2-nitrophenoxy]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)-2-nitrophenoxy]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 4215025 |
| Molecular Formula | C14H18F3N3O6S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)-2-nitrophenoxy]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OCC(=O)NCC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18F3N3O6S/c1-3-19(4-2)27(24,25)10-5-6-12(11(7-10)20(22)23)26-8-13(21)18-9-14(15,16)17/h5-7H,3-4,8-9H2,1-2H3,(H,18,21) |
| InChIKey | TXMYOFHPDCRKIZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|