C15H24N4O6S — CID 119407055
N-(3-aminopropyl)-2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetamide (PubChem CID 119407055) has the molecular formula C15H24N4O6S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetamide.
| Compound Name | N-(3-aminopropyl)-2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetamide |
|---|---|
| PubChem CID | 119407055 |
| Molecular Formula | C15H24N4O6S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-(3-aminopropyl)-2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OCC(=O)NCCCN)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H24N4O6S/c1-3-18(4-2)26(23,24)12-6-7-14(13(10-12)19(21)22)25-11-15(20)17-9-5-8-16/h6-7,10H,3-5,8-9,11,16H2,1-2H3,(H,17,20) |
| InChIKey | RXXBQJMLRJNCIV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|