C17H26N4O7S — CID 27323109
N-(butylcarbamoyl)-2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetamide (PubChem CID 27323109) has the molecular formula C17H26N4O7S and a molecular weight of 430.48 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetamide.
| Compound Name | N-(butylcarbamoyl)-2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetamide |
|---|---|
| PubChem CID | 27323109 |
| Molecular Formula | C17H26N4O7S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-(butylcarbamoyl)-2-[4-(diethylsulfamoyl)-2-nitrophenoxy]acetamide |
| SMILES | CCCCNC(=O)NC(=O)COc1ccc(S(=O)(=O)N(CC)CC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N4O7S/c1-4-7-10-18-17(23)19-16(22)12-28-15-9-8-13(11-14(15)21(24)25)29(26,27)20(5-2)6-3/h8-9,11H,4-7,10,12H2,1-3H3,(H2,18,19,22,23) |
| InChIKey | PNMQFTSTSZZOEX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|