C19H29N3O6S — CID 3331320
4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 3331320) has the molecular formula C19H29N3O6S and a molecular weight of 427.52 g/mol. Its IUPAC name is 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3331320 |
| Molecular Formula | C19H29N3O6S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OCC(=O)N2C(C)CCCC2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H29N3O6S/c1-5-20(6-2)29(26,27)16-10-11-18(17(12-16)22(24)25)28-13-19(23)21-14(3)8-7-9-15(21)4/h10-12,14-15H,5-9,13H2,1-4H3 |
| InChIKey | LYNZTBQMBPHHHG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|