C16H22N2O6S — CID 7546626
N,N-diethyl-3-nitro-4-[(1S)-2-oxocyclohexyl]oxybenzenesulfonamide (PubChem CID 7546626) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is N,N-diethyl-3-nitro-4-[(1S)-2-oxocyclohexyl]oxybenzenesulfonamide.
| Compound Name | N,N-diethyl-3-nitro-4-[(1S)-2-oxocyclohexyl]oxybenzenesulfonamide |
|---|---|
| PubChem CID | 7546626 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N,N-diethyl-3-nitro-4-[(1S)-2-oxocyclohexyl]oxybenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O[C@H]2CCCCC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H22N2O6S/c1-3-17(4-2)25(22,23)12-9-10-15(13(11-12)18(20)21)24-16-8-6-5-7-14(16)19/h9-11,16H,3-8H2,1-2H3/t16-/m0/s1 |
| InChIKey | FAUGFRZBWXMXAL-INIZCTEOSA-N |
| XLogP | 2.52 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|