C17H21N3O7S2 — CID 5031227
N-[4-(diethylsulfamoyl)phenyl]-4-methoxy-3-nitrobenzenesulfonamide (PubChem CID 5031227) has the molecular formula C17H21N3O7S2 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-4-methoxy-3-nitrobenzenesulfonamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-4-methoxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 5031227 |
| Molecular Formula | C17H21N3O7S2 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-4-methoxy-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(OC)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H21N3O7S2/c1-4-19(5-2)29(25,26)14-8-6-13(7-9-14)18-28(23,24)15-10-11-17(27-3)16(12-15)20(21)22/h6-12,18H,4-5H2,1-3H3 |
| InChIKey | WXFSVWZKHKNZAK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|