C13H17N3O5S — CID 7546658
4-[(1S)-1-cyanoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 7546658) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is 4-[(1S)-1-cyanoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(1S)-1-cyanoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 7546658 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 4-[(1S)-1-cyanoethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O[C@@H](C)C#N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N3O5S/c1-4-15(5-2)22(19,20)11-6-7-13(21-10(3)9-14)12(8-11)16(17)18/h6-8,10H,4-5H2,1-3H3/t10-/m0/s1 |
| InChIKey | DOZJBAWCDFBKDI-JTQLQIEISA-N |
| XLogP | 1.92 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|