C18H26N4O6S — CID 42946085
4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 42946085) has the molecular formula C18H26N4O6S and a molecular weight of 426.50 g/mol. Its IUPAC name is 4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 42946085 |
| Molecular Formula | C18H26N4O6S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethoxy]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC(C)c2nc(C(C)(C)C)no2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H26N4O6S/c1-7-21(8-2)29(25,26)13-9-10-15(14(11-13)22(23)24)27-12(3)16-19-17(20-28-16)18(4,5)6/h9-12H,7-8H2,1-6H3 |
| InChIKey | LQTUUUAFINQOAM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 128.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|