C18H21FN2O5S — CID 7546717
N,N-diethyl-4-[(1S)-1-(4-fluorophenyl)ethoxy]-3-nitrobenzenesulfonamide (PubChem CID 7546717) has the molecular formula C18H21FN2O5S and a molecular weight of 396.44 g/mol. Its IUPAC name is N,N-diethyl-4-[(1S)-1-(4-fluorophenyl)ethoxy]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(1S)-1-(4-fluorophenyl)ethoxy]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 7546717 |
| Molecular Formula | C18H21FN2O5S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N,N-diethyl-4-[(1S)-1-(4-fluorophenyl)ethoxy]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O[C@@H](C)c2ccc(F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H21FN2O5S/c1-4-20(5-2)27(24,25)16-10-11-18(17(12-16)21(22)23)26-13(3)14-6-8-15(19)9-7-14/h6-13H,4-5H2,1-3H3/t13-/m0/s1 |
| InChIKey | WQPWKRRSHBWUFC-ZDUSSCGKSA-N |
| XLogP | 3.90 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|