C18H21F2N3O4S — CID 9107680
4-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 9107680) has the molecular formula C18H21F2N3O4S and a molecular weight of 413.45 g/mol. Its IUPAC name is 4-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9107680 |
| Molecular Formula | C18H21F2N3O4S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N[C@H](C)c2ccc(F)c(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H21F2N3O4S/c1-4-22(5-2)28(26,27)14-7-9-17(18(11-14)23(24)25)21-12(3)13-6-8-15(19)16(20)10-13/h6-12,21H,4-5H2,1-3H3/t12-/m1/s1 |
| InChIKey | GALWPAHQUHASSD-GFCCVEGCSA-N |
| XLogP | 4.08 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|