C15H14F2N2O4S — CID 9107653
N-[(1S)-1-(3,4-difluorophenyl)ethyl]-4-methylsulfonyl-2-nitroaniline (PubChem CID 9107653) has the molecular formula C15H14F2N2O4S and a molecular weight of 356.35 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-difluorophenyl)ethyl]-4-methylsulfonyl-2-nitroaniline.
| Compound Name | N-[(1S)-1-(3,4-difluorophenyl)ethyl]-4-methylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 9107653 |
| Molecular Formula | C15H14F2N2O4S |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | N-[(1S)-1-(3,4-difluorophenyl)ethyl]-4-methylsulfonyl-2-nitroaniline |
| SMILES | C[C@H](Nc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H14F2N2O4S/c1-9(10-3-5-12(16)13(17)7-10)18-14-6-4-11(24(2,22)23)8-15(14)19(20)21/h3-9,18H,1-2H3/t9-/m0/s1 |
| InChIKey | XDELBYISDULWHU-VIFPVBQESA-N |
| XLogP | 3.45 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|